C23H36O — CID 54082788
(3S,10R,13S,17R)-17-but-2-en-2-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 54082788) has the molecular formula C23H36O and a molecular weight of 328.54 g/mol. Its IUPAC name is (3S,10R,13S,17R)-17-but-2-en-2-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10R,13S,17R)-17-but-2-en-2-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 54082788 |
| Molecular Formula | C23H36O |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | (3S,10R,13S,17R)-17-but-2-en-2-yl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC=C(C)[C@H]1CCC2C3CC=C4C[C@@H](O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C23H36O/c1-5-15(2)19-8-9-20-18-7-6-16-14-17(24)10-12-22(16,3)21(18)11-13-23(19,20)4/h5-6,17-21,24H,7-14H2,1-4H3/t17-,18?,19+,20?,21?,22-,23+/m0/s1 |
| InChIKey | MOHFPMTXGBIVIT-HHHKLVRJSA-N |
| XLogP | 5.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|