About 2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneethanamine
2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneethanamine (PubChem CID 54082998) has the molecular formula C15H19N
and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneethanamine.
Molecular Properties
| Compound Name | 2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneethanamine |
| PubChem CID | 54082998 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneethanamine |
| SMILES | NCC=C1CC2(CCCC2)c2ccccc21 |
| InChI | InChI=1S/C15H19N/c16-10-7-12-11-15(8-3-4-9-15)14-6-2-1-5-13(12)14/h1-2,5-7H,3-4,8-11,16H2 |
| InChIKey | MOLCDZQBOUICDO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneethanamine?
The IUPAC name of 2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneethanamine (CID 54082998) is 2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneethanamine.
What is the SMILES notation for 2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneethanamine?
The canonical SMILES for 2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneethanamine is NCC=C1CC2(CCCC2)c2ccccc21.
What is the InChIKey of 2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneethanamine?
The InChIKey is MOLCDZQBOUICDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N/c16-10-7-12-11-15(8-3-4-9-15)14-6-2-1-5-13(12)14/h1-2,5-7H,3-4,8-11,16H2.
What are the key properties of 2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneethanamine?
2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneethanamine has a molecular weight of 213.32 g/mol, XLogP of 3.24, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-spiro[2H-indene-3,1'-cyclopentane]-1-ylideneethanamine is sourced from PubChem (CID 54082998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).