C22H18N2O2 — CID 5408315
(Z)-N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]fluoren-9-imine (PubChem CID 5408315) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is (Z)-N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]fluoren-9-imine.
| Compound Name | (Z)-N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]fluoren-9-imine |
|---|---|
| PubChem CID | 5408315 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (Z)-N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]fluoren-9-imine |
| SMILES | COc1ccc(/C=N\N=C2c3ccccc3-c3ccccc32)cc1OC |
| InChI | InChI=1S/C22H18N2O2/c1-25-20-12-11-15(13-21(20)26-2)14-23-24-22-18-9-5-3-7-16(18)17-8-4-6-10-19(17)22/h3-14H,1-2H3/b23-14- |
| InChIKey | PKYBRJZWVUWFCJ-UCQKPKSFSA-N |
| XLogP | 4.56 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|