C22H25NO — CID 54083505
2,2,4-trimethyl-5-propyl-1,5-dihydrochromeno[3,4-f]quinoline (PubChem CID 54083505) has the molecular formula C22H25NO and a molecular weight of 319.45 g/mol. Its IUPAC name is 2,2,4-trimethyl-5-propyl-1,5-dihydrochromeno[3,4-f]quinoline.
| Compound Name | 2,2,4-trimethyl-5-propyl-1,5-dihydrochromeno[3,4-f]quinoline |
|---|---|
| PubChem CID | 54083505 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 2,2,4-trimethyl-5-propyl-1,5-dihydrochromeno[3,4-f]quinoline |
| SMILES | CCCC1Oc2ccccc2-c2ccc3c(c21)C(C)=CC(C)(C)N3 |
| InChI | InChI=1S/C22H25NO/c1-5-8-19-21-16(15-9-6-7-10-18(15)24-19)11-12-17-20(21)14(2)13-22(3,4)23-17/h6-7,9-13,19,23H,5,8H2,1-4H3 |
| InChIKey | MOUIXPBXWXQVKE-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |