C17H21NO7S — CID 54083538
ethyl (4R,7R)-12,14-dihydroxy-4,15-dimethyl-2,5-dioxo-3-oxa-9-thia-6-azabicyclo[9.4.0]pentadeca-1(15),11,13-triene-7-carboxylate (PubChem CID 54083538) has the molecular formula C17H21NO7S and a molecular weight of 383.42 g/mol. Its IUPAC name is ethyl (4R,7R)-12,14-dihydroxy-4,15-dimethyl-2,5-dioxo-3-oxa-9-thia-6-azabicyclo[9.4.0]pentadeca-1(15),11,13-triene-7-carboxylate.
| Compound Name | ethyl (4R,7R)-12,14-dihydroxy-4,15-dimethyl-2,5-dioxo-3-oxa-9-thia-6-azabicyclo[9.4.0]pentadeca-1(15),11,13-triene-7-carboxylate |
|---|---|
| PubChem CID | 54083538 |
| Molecular Formula | C17H21NO7S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | ethyl (4R,7R)-12,14-dihydroxy-4,15-dimethyl-2,5-dioxo-3-oxa-9-thia-6-azabicyclo[9.4.0]pentadeca-1(15),11,13-triene-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CSCc2c(O)cc(O)c(C)c2C(=O)O[C@H](C)C(=O)N1 |
| InChI | InChI=1S/C17H21NO7S/c1-4-24-16(22)11-7-26-6-10-13(20)5-12(19)8(2)14(10)17(23)25-9(3)15(21)18-11/h5,9,11,19-20H,4,6-7H2,1-3H3,(H,18,21)/t9-,11+/m1/s1 |
| InChIKey | MOUVWLBRDKBKNZ-KOLCDFICSA-N |
| XLogP | 1.25 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |