C14H17F2NO — CID 54083909
2-(2,6-difluorophenyl)-5,5-diethyl-4,6-dihydro-1,3-oxazine (PubChem CID 54083909) has the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-5,5-diethyl-4,6-dihydro-1,3-oxazine.
| Compound Name | 2-(2,6-difluorophenyl)-5,5-diethyl-4,6-dihydro-1,3-oxazine |
|---|---|
| PubChem CID | 54083909 |
| Molecular Formula | C14H17F2NO |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-(2,6-difluorophenyl)-5,5-diethyl-4,6-dihydro-1,3-oxazine |
| SMILES | CCC1(CC)CN=C(c2c(F)cccc2F)OC1 |
| InChI | InChI=1S/C14H17F2NO/c1-3-14(4-2)8-17-13(18-9-14)12-10(15)6-5-7-11(12)16/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | MPBCKKPCKWEKTA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |