C15H19F9N2O2 — CID 54083954
N-(5,5,6,6,7,7,8,8,8-nonafluoro-2-methyl-4-oxooctan-3-yl)piperidine-2-carboxamide (PubChem CID 54083954) has the molecular formula C15H19F9N2O2 and a molecular weight of 430.31 g/mol. Its IUPAC name is N-(5,5,6,6,7,7,8,8,8-nonafluoro-2-methyl-4-oxooctan-3-yl)piperidine-2-carboxamide.
| Compound Name | N-(5,5,6,6,7,7,8,8,8-nonafluoro-2-methyl-4-oxooctan-3-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 54083954 |
| Molecular Formula | C15H19F9N2O2 |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | N-(5,5,6,6,7,7,8,8,8-nonafluoro-2-methyl-4-oxooctan-3-yl)piperidine-2-carboxamide |
| SMILES | CC(C)C(NC(=O)C1CCCCN1)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H19F9N2O2/c1-7(2)9(26-11(28)8-5-3-4-6-25-8)10(27)12(16,17)13(18,19)14(20,21)15(22,23)24/h7-9,25H,3-6H2,1-2H3,(H,26,28) |
| InChIKey | MPBWCTWYIGUGPM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|