C20H46Si4 — CID 54084160
trimethyl-[1,7,8-tris(trimethylsilyl)octa-1,7-dien-2-yl]silane (PubChem CID 54084160) has the molecular formula C20H46Si4 and a molecular weight of 398.93 g/mol. Its IUPAC name is trimethyl-[1,7,8-tris(trimethylsilyl)octa-1,7-dien-2-yl]silane.
| Compound Name | trimethyl-[1,7,8-tris(trimethylsilyl)octa-1,7-dien-2-yl]silane |
|---|---|
| PubChem CID | 54084160 |
| Molecular Formula | C20H46Si4 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | trimethyl-[1,7,8-tris(trimethylsilyl)octa-1,7-dien-2-yl]silane |
| SMILES | C[Si](C)(C)C=C(CCCCC(=C[Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C20H46Si4/c1-21(2,3)17-19(23(7,8)9)15-13-14-16-20(24(10,11)12)18-22(4,5)6/h17-18H,13-16H2,1-12H3 |
| InChIKey | MPFRCWYHLUIVSL-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|