About 1-O-ethyl 2-O-[1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)but-3-enyl] oxalate
1-O-ethyl 2-O-[1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)but-3-enyl] oxalate (PubChem CID 54084683) has the molecular formula C17H24O5
and a molecular weight of 308.37 g/mol. Its IUPAC name is 1-O-ethyl 2-O-[1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)but-3-enyl] oxalate.
Molecular Properties
| Compound Name | 1-O-ethyl 2-O-[1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)but-3-enyl] oxalate |
| PubChem CID | 54084683 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 1-O-ethyl 2-O-[1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)but-3-enyl] oxalate |
| SMILES | C=CCC(OC(=O)C(=O)OCC)C1=C(C)C(=O)CCC1(C)C |
| InChI | InChI=1S/C17H24O5/c1-6-8-13(22-16(20)15(19)21-7-2)14-11(3)12(18)9-10-17(14,4)5/h6,13H,1,7-10H2,2-5H3 |
| InChIKey | MPOWLDWYQDJCJI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 2-O-[1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)but-3-enyl] oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 2-O-[1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)but-3-enyl] oxalate?
The IUPAC name of 1-O-ethyl 2-O-[1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)but-3-enyl] oxalate (CID 54084683) is 1-O-ethyl 2-O-[1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)but-3-enyl] oxalate.
What is the SMILES notation for 1-O-ethyl 2-O-[1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)but-3-enyl] oxalate?
The canonical SMILES for 1-O-ethyl 2-O-[1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)but-3-enyl] oxalate is C=CCC(OC(=O)C(=O)OCC)C1=C(C)C(=O)CCC1(C)C.
What is the InChIKey of 1-O-ethyl 2-O-[1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)but-3-enyl] oxalate?
The InChIKey is MPOWLDWYQDJCJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O5/c1-6-8-13(22-16(20)15(19)21-7-2)14-11(3)12(18)9-10-17(14,4)5/h6,13H,1,7-10H2,2-5H3.
What are the key properties of 1-O-ethyl 2-O-[1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)but-3-enyl] oxalate?
1-O-ethyl 2-O-[1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)but-3-enyl] oxalate has a molecular weight of 308.37 g/mol, XLogP of 2.74, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 2-O-[1-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)but-3-enyl] oxalate is sourced from PubChem (CID 54084683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).