About 1-bromo-6,6-diethoxy-4-methylhexa-1,3-diene
1-bromo-6,6-diethoxy-4-methylhexa-1,3-diene (PubChem CID 54085110) has the molecular formula C11H19BrO2
and a molecular weight of 263.17 g/mol. Its IUPAC name is 1-bromo-6,6-diethoxy-4-methylhexa-1,3-diene.
Molecular Properties
| Compound Name | 1-bromo-6,6-diethoxy-4-methylhexa-1,3-diene |
| PubChem CID | 54085110 |
| Molecular Formula | C11H19BrO2 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 1-bromo-6,6-diethoxy-4-methylhexa-1,3-diene |
| SMILES | CCOC(CC(C)=CC=CBr)OCC |
| InChI | InChI=1S/C11H19BrO2/c1-4-13-11(14-5-2)9-10(3)7-6-8-12/h6-8,11H,4-5,9H2,1-3H3 |
| InChIKey | MPXCQFKGCCWFJY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-6,6-diethoxy-4-methylhexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-6,6-diethoxy-4-methylhexa-1,3-diene?
The IUPAC name of 1-bromo-6,6-diethoxy-4-methylhexa-1,3-diene (CID 54085110) is 1-bromo-6,6-diethoxy-4-methylhexa-1,3-diene.
What is the SMILES notation for 1-bromo-6,6-diethoxy-4-methylhexa-1,3-diene?
The canonical SMILES for 1-bromo-6,6-diethoxy-4-methylhexa-1,3-diene is CCOC(CC(C)=CC=CBr)OCC.
What is the InChIKey of 1-bromo-6,6-diethoxy-4-methylhexa-1,3-diene?
The InChIKey is MPXCQFKGCCWFJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19BrO2/c1-4-13-11(14-5-2)9-10(3)7-6-8-12/h6-8,11H,4-5,9H2,1-3H3.
What are the key properties of 1-bromo-6,6-diethoxy-4-methylhexa-1,3-diene?
1-bromo-6,6-diethoxy-4-methylhexa-1,3-diene has a molecular weight of 263.17 g/mol, XLogP of 3.63, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-6,6-diethoxy-4-methylhexa-1,3-diene is sourced from PubChem (CID 54085110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).