C19H26N4O6S — CID 54085387
(2S)-4-amino-2-[[(2S)-2-[[(2R)-2-benzamido-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-4-oxobutanoic acid (PubChem CID 54085387) has the molecular formula C19H26N4O6S and a molecular weight of 438.51 g/mol. Its IUPAC name is (2S)-4-amino-2-[[(2S)-2-[[(2R)-2-benzamido-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[[(2S)-2-[[(2R)-2-benzamido-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54085387 |
| Molecular Formula | C19H26N4O6S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (2S)-4-amino-2-[[(2S)-2-[[(2R)-2-benzamido-3-sulfanylpropanoyl]amino]-3-methylbutanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CS)NC(=O)c1ccccc1)C(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C19H26N4O6S/c1-10(2)15(18(27)21-12(19(28)29)8-14(20)24)23-17(26)13(9-30)22-16(25)11-6-4-3-5-7-11/h3-7,10,12-13,15,30H,8-9H2,1-2H3,(H2,20,24)(H,21,27)(H,22,25)(H,23,26)(H,28,29)/t12-,13-,15-/m0/s1 |
| InChIKey | MQBWTHYOBDHQLW-YDHLFZDLSA-N |
| XLogP | -0.70 |
| TPSA | 167.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|