C6F10 — CID 54085414
1,1,2,3,4,5,5,6,6,6-decafluorohexa-1,3-diene (PubChem CID 54085414) has the molecular formula C6F10 and a molecular weight of 262.05 g/mol. Its IUPAC name is 1,1,2,3,4,5,5,6,6,6-decafluorohexa-1,3-diene.
| Compound Name | 1,1,2,3,4,5,5,6,6,6-decafluorohexa-1,3-diene |
|---|---|
| PubChem CID | 54085414 |
| Molecular Formula | C6F10 |
| Molecular Weight | 262.05 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | 1,1,2,3,4,5,5,6,6,6-decafluorohexa-1,3-diene |
| SMILES | FC(F)=C(F)C(F)=C(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6F10/c7-1(2(8)4(10)11)3(9)5(12,13)6(14,15)16 |
| InChIKey | MQCKWLJZPAVXSA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.05 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|