C25H35FO4Si — CID 54085834
2-[(2S,3S,4R,5R,6S)-3-fluoro-6-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxyethyl-trimethylsilane (PubChem CID 54085834) has the molecular formula C25H35FO4Si and a molecular weight of 446.64 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R,6S)-3-fluoro-6-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxyethyl-trimethylsilane.
| Compound Name | 2-[(2S,3S,4R,5R,6S)-3-fluoro-6-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxyethyl-trimethylsilane |
|---|---|
| PubChem CID | 54085834 |
| Molecular Formula | C25H35FO4Si |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | 2-[(2S,3S,4R,5R,6S)-3-fluoro-6-methyl-4,5-bis(phenylmethoxy)oxan-2-yl]oxyethyl-trimethylsilane |
| SMILES | C[C@@H]1O[C@H](OCC[Si](C)(C)C)[C@@H](F)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H35FO4Si/c1-19-23(28-17-20-11-7-5-8-12-20)24(29-18-21-13-9-6-10-14-21)22(26)25(30-19)27-15-16-31(2,3)4/h5-14,19,22-25H,15-18H2,1-4H3/t19-,22-,23+,24-,25-/m0/s1 |
| InChIKey | MQJRFOXWNJCIGG-BNFFBFCJSA-N |
| XLogP | 5.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|