About 5-hydroxyheptan-2-one
5-hydroxyheptan-2-one (PubChem CID 54086231) has the molecular formula C7H14O2
and a molecular weight of 130.19 g/mol. Its IUPAC name is 5-hydroxyheptan-2-one.
Molecular Properties
| Compound Name | 5-hydroxyheptan-2-one |
| PubChem CID | 54086231 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | 5-hydroxyheptan-2-one |
| SMILES | CCC(O)CCC(C)=O |
| InChI | InChI=1S/C7H14O2/c1-3-7(9)5-4-6(2)8/h7,9H,3-5H2,1-2H3 |
| InChIKey | MQRALIJAASQPNT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-hydroxyheptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxyheptan-2-one?
The IUPAC name of 5-hydroxyheptan-2-one (CID 54086231) is 5-hydroxyheptan-2-one.
What is the SMILES notation for 5-hydroxyheptan-2-one?
The canonical SMILES for 5-hydroxyheptan-2-one is CCC(O)CCC(C)=O.
What is the InChIKey of 5-hydroxyheptan-2-one?
The InChIKey is MQRALIJAASQPNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2/c1-3-7(9)5-4-6(2)8/h7,9H,3-5H2,1-2H3.
What are the key properties of 5-hydroxyheptan-2-one?
5-hydroxyheptan-2-one has a molecular weight of 130.19 g/mol, XLogP of 1.13, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxyheptan-2-one is sourced from PubChem (CID 54086231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).