C15H18N2O3 — CID 54086250
(3R,8R)-5-methyl-13-nitro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),12,14-trien-10-one (PubChem CID 54086250) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (3R,8R)-5-methyl-13-nitro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),12,14-trien-10-one.
| Compound Name | (3R,8R)-5-methyl-13-nitro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),12,14-trien-10-one |
|---|---|
| PubChem CID | 54086250 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (3R,8R)-5-methyl-13-nitro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),12,14-trien-10-one |
| SMILES | CN1CC[C@@H]2CC(=O)c3cc([N+](=O)[O-])ccc3C[C@H]2C1 |
| InChI | InChI=1S/C15H18N2O3/c1-16-5-4-10-7-15(18)14-8-13(17(19)20)3-2-11(14)6-12(10)9-16/h2-3,8,10,12H,4-7,9H2,1H3/t10-,12+/m1/s1 |
| InChIKey | MQRIOSXYROAWDT-PWSUYJOCSA-N |
| XLogP | 2.29 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|