About (5-methyl-2-propan-2-ylphenyl) hypobromite
(5-methyl-2-propan-2-ylphenyl) hypobromite (PubChem CID 54086840) has the molecular formula C10H13BrO
and a molecular weight of 229.12 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylphenyl) hypobromite.
Molecular Properties
| Compound Name | (5-methyl-2-propan-2-ylphenyl) hypobromite |
| PubChem CID | 54086840 |
| Molecular Formula | C10H13BrO |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | (5-methyl-2-propan-2-ylphenyl) hypobromite |
| SMILES | Cc1ccc(C(C)C)c(OBr)c1 |
| InChI | InChI=1S/C10H13BrO/c1-7(2)9-5-4-8(3)6-10(9)12-11/h4-7H,1-3H3 |
| InChIKey | MRCADRXNIHVJNH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5-methyl-2-propan-2-ylphenyl) hypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-2-propan-2-ylphenyl) hypobromite?
The IUPAC name of (5-methyl-2-propan-2-ylphenyl) hypobromite (CID 54086840) is (5-methyl-2-propan-2-ylphenyl) hypobromite.
What is the SMILES notation for (5-methyl-2-propan-2-ylphenyl) hypobromite?
The canonical SMILES for (5-methyl-2-propan-2-ylphenyl) hypobromite is Cc1ccc(C(C)C)c(OBr)c1.
What is the InChIKey of (5-methyl-2-propan-2-ylphenyl) hypobromite?
The InChIKey is MRCADRXNIHVJNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrO/c1-7(2)9-5-4-8(3)6-10(9)12-11/h4-7H,1-3H3.
What are the key properties of (5-methyl-2-propan-2-ylphenyl) hypobromite?
(5-methyl-2-propan-2-ylphenyl) hypobromite has a molecular weight of 229.12 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-2-propan-2-ylphenyl) hypobromite is sourced from PubChem (CID 54086840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).