C16H22N2O7 — CID 54086882
ethyl 2-[[2-methyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carbonyl]amino]acetate (PubChem CID 54086882) has the molecular formula C16H22N2O7 and a molecular weight of 354.36 g/mol. Its IUPAC name is ethyl 2-[[2-methyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[2-methyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 54086882 |
| Molecular Formula | C16H22N2O7 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | ethyl 2-[[2-methyl-10-(methylcarbamoyloxy)-3,9-dioxatricyclo[4.4.0.02,4]dec-7-ene-7-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C1=COC(OC(=O)NC)C2C1CC1OC12C |
| InChI | InChI=1S/C16H22N2O7/c1-4-22-11(19)6-18-13(20)9-7-23-14(24-15(21)17-3)12-8(9)5-10-16(12,2)25-10/h7-8,10,12,14H,4-6H2,1-3H3,(H,17,21)(H,18,20) |
| InChIKey | MRCSGWPWZOPEFN-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 115.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|