About 5,5-difluoro-3-methylpent-2-ene-1,4-diamine
5,5-difluoro-3-methylpent-2-ene-1,4-diamine (PubChem CID 54087168) has the molecular formula C6H12F2N2
and a molecular weight of 150.17 g/mol. Its IUPAC name is 5,5-difluoro-3-methylpent-2-ene-1,4-diamine.
Molecular Properties
| Compound Name | 5,5-difluoro-3-methylpent-2-ene-1,4-diamine |
| PubChem CID | 54087168 |
| Molecular Formula | C6H12F2N2 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 5,5-difluoro-3-methylpent-2-ene-1,4-diamine |
| SMILES | CC(=CCN)C(N)C(F)F |
| InChI | InChI=1S/C6H12F2N2/c1-4(2-3-9)5(10)6(7)8/h2,5-6H,3,9-10H2,1H3 |
| InChIKey | MRHDOIFCDNDWHI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,5-difluoro-3-methylpent-2-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoro-3-methylpent-2-ene-1,4-diamine?
The IUPAC name of 5,5-difluoro-3-methylpent-2-ene-1,4-diamine (CID 54087168) is 5,5-difluoro-3-methylpent-2-ene-1,4-diamine.
What is the SMILES notation for 5,5-difluoro-3-methylpent-2-ene-1,4-diamine?
The canonical SMILES for 5,5-difluoro-3-methylpent-2-ene-1,4-diamine is CC(=CCN)C(N)C(F)F.
What is the InChIKey of 5,5-difluoro-3-methylpent-2-ene-1,4-diamine?
The InChIKey is MRHDOIFCDNDWHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12F2N2/c1-4(2-3-9)5(10)6(7)8/h2,5-6H,3,9-10H2,1H3.
What are the key properties of 5,5-difluoro-3-methylpent-2-ene-1,4-diamine?
5,5-difluoro-3-methylpent-2-ene-1,4-diamine has a molecular weight of 150.17 g/mol, XLogP of 0.48, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-3-methylpent-2-ene-1,4-diamine is sourced from PubChem (CID 54087168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).