C25H26N2O5 — CID 54087734
[4-[[5-[(4-methoxyphenyl)methylidene]-3,6-dioxopiperazin-2-ylidene]methyl]phenyl] 3,3-dimethylbutanoate (PubChem CID 54087734) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is [4-[[5-[(4-methoxyphenyl)methylidene]-3,6-dioxopiperazin-2-ylidene]methyl]phenyl] 3,3-dimethylbutanoate.
| Compound Name | [4-[[5-[(4-methoxyphenyl)methylidene]-3,6-dioxopiperazin-2-ylidene]methyl]phenyl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 54087734 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | [4-[[5-[(4-methoxyphenyl)methylidene]-3,6-dioxopiperazin-2-ylidene]methyl]phenyl] 3,3-dimethylbutanoate |
| SMILES | COc1ccc(C=c2[nH]c(=O)c(=Cc3ccc(OC(=O)CC(C)(C)C)cc3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C25H26N2O5/c1-25(2,3)15-22(28)32-19-11-7-17(8-12-19)14-21-24(30)26-20(23(29)27-21)13-16-5-9-18(31-4)10-6-16/h5-14H,15H2,1-4H3,(H,26,30)(H,27,29) |
| InChIKey | MRQVFIGWDAHTEY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|