C11H11BrF3N3O3 — CID 540880
methyl 2-acetamido-2-[(5-bromo-2-pyridinyl)amino]-3,3,3-trifluoropropanoate (PubChem CID 540880) has the molecular formula C11H11BrF3N3O3 and a molecular weight of 370.13 g/mol. Its IUPAC name is methyl 2-acetamido-2-[(5-bromo-2-pyridinyl)amino]-3,3,3-trifluoropropanoate.
| Compound Name | methyl 2-acetamido-2-[(5-bromo-2-pyridinyl)amino]-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 540880 |
| Molecular Formula | C11H11BrF3N3O3 |
| Molecular Weight | 370.13 g/mol |
| Exact Mass | 368.99 |
| IUPAC Name | methyl 2-acetamido-2-[(5-bromo-2-pyridinyl)amino]-3,3,3-trifluoropropanoate |
| SMILES | COC(=O)C(NC(C)=O)(Nc1ccc(Br)cn1)C(F)(F)F |
| InChI | InChI=1S/C11H11BrF3N3O3/c1-6(19)17-10(9(20)21-2,11(13,14)15)18-8-4-3-7(12)5-16-8/h3-5H,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | ACTCWGQGGHXOAJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.13 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|