C12H22N2O3 — CID 54088009
tert-butyl N-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-6-yl)carbamate (PubChem CID 54088009) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is tert-butyl N-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-6-yl)carbamate.
| Compound Name | tert-butyl N-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-6-yl)carbamate |
|---|---|
| PubChem CID | 54088009 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | tert-butyl N-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-6-yl)carbamate |
| SMILES | CC1CC2NCC(NC(=O)OC(C)(C)C)C2O1 |
| InChI | InChI=1S/C12H22N2O3/c1-7-5-8-10(16-7)9(6-13-8)14-11(15)17-12(2,3)4/h7-10,13H,5-6H2,1-4H3,(H,14,15) |
| InChIKey | MRVUSPQLODMLCQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |