C16H28O2 — CID 54088411
4-hydroxy-4,8,12-trimethyltrideca-7,11-dienal (PubChem CID 54088411) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 4-hydroxy-4,8,12-trimethyltrideca-7,11-dienal.
| Compound Name | 4-hydroxy-4,8,12-trimethyltrideca-7,11-dienal |
|---|---|
| PubChem CID | 54088411 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 4-hydroxy-4,8,12-trimethyltrideca-7,11-dienal |
| SMILES | CC(C)=CCCC(C)=CCCC(C)(O)CCC=O |
| InChI | InChI=1S/C16H28O2/c1-14(2)8-5-9-15(3)10-6-11-16(4,18)12-7-13-17/h8,10,13,18H,5-7,9,11-12H2,1-4H3 |
| InChIKey | MSCRWCNSVKFBEO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|