About ethane;naphthalene-1,4-dione
ethane;naphthalene-1,4-dione (PubChem CID 54088717) has the molecular formula C14H18O2
and a molecular weight of 218.30 g/mol. Its IUPAC name is ethane;naphthalene-1,4-dione.
Molecular Properties
| Compound Name | ethane;naphthalene-1,4-dione |
| PubChem CID | 54088717 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | ethane;naphthalene-1,4-dione |
| SMILES | CC.CC.O=C1C=CC(=O)c2ccccc21 |
| InChI | InChI=1S/C10H6O2.2C2H6/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;2*1-2/h1-6H;2*1-2H3 |
| InChIKey | MSIPOTJFKWQBSS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze ethane;naphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;naphthalene-1,4-dione?
The IUPAC name of ethane;naphthalene-1,4-dione (CID 54088717) is ethane;naphthalene-1,4-dione.
What is the SMILES notation for ethane;naphthalene-1,4-dione?
The canonical SMILES for ethane;naphthalene-1,4-dione is CC.CC.O=C1C=CC(=O)c2ccccc21.
What is the InChIKey of ethane;naphthalene-1,4-dione?
The InChIKey is MSIPOTJFKWQBSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6O2.2C2H6/c11-9-5-6-10(12)8-4-2-1-3-7(8)9;2*1-2/h1-6H;2*1-2H3.
What are the key properties of ethane;naphthalene-1,4-dione?
ethane;naphthalene-1,4-dione has a molecular weight of 218.30 g/mol, XLogP of 3.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;naphthalene-1,4-dione is sourced from PubChem (CID 54088717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).