About methyl 7-[(1R,2R)-2-(6-methoxy-4,4-dimethylhex-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate
methyl 7-[(1R,2R)-2-(6-methoxy-4,4-dimethylhex-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate (PubChem CID 54088899) has the molecular formula C22H36O5
and a molecular weight of 380.53 g/mol. Its IUPAC name is methyl 7-[(1R,2R)-2-(6-methoxy-4,4-dimethylhex-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate.
Molecular Properties
| Compound Name | methyl 7-[(1R,2R)-2-(6-methoxy-4,4-dimethylhex-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate |
| PubChem CID | 54088899 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | methyl 7-[(1R,2R)-2-(6-methoxy-4,4-dimethylhex-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate |
| SMILES | COCCC(C)(C)CC=C[C@H]1CCC(=O)[C@@H]1CCCCCC(=O)C(=O)OC |
| InChI | InChI=1S/C22H36O5/c1-22(2,15-16-26-3)14-8-9-17-12-13-19(23)18(17)10-6-5-7-11-20(24)21(25)27-4/h8-9,17-18H,5-7,10-16H2,1-4H3/t17-,18+/m0/s1 |
| InChIKey | MSLXRWGQKNXTAY-ZWKOTPCHSA-N |
| XLogP | 4.28 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[(1R,2R)-2-(6-methoxy-4,4-dimethylhex-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[(1R,2R)-2-(6-methoxy-4,4-dimethylhex-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate?
The IUPAC name of methyl 7-[(1R,2R)-2-(6-methoxy-4,4-dimethylhex-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate (CID 54088899) is methyl 7-[(1R,2R)-2-(6-methoxy-4,4-dimethylhex-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate.
What is the SMILES notation for methyl 7-[(1R,2R)-2-(6-methoxy-4,4-dimethylhex-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate?
The canonical SMILES for methyl 7-[(1R,2R)-2-(6-methoxy-4,4-dimethylhex-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate is COCCC(C)(C)CC=C[C@H]1CCC(=O)[C@@H]1CCCCCC(=O)C(=O)OC.
What is the InChIKey of methyl 7-[(1R,2R)-2-(6-methoxy-4,4-dimethylhex-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate?
The InChIKey is MSLXRWGQKNXTAY-ZWKOTPCHSA-N. The full InChI is InChI=1S/C22H36O5/c1-22(2,15-16-26-3)14-8-9-17-12-13-19(23)18(17)10-6-5-7-11-20(24)21(25)27-4/h8-9,17-18H,5-7,10-16H2,1-4H3/t17-,18+/m0/s1.
What are the key properties of methyl 7-[(1R,2R)-2-(6-methoxy-4,4-dimethylhex-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate?
methyl 7-[(1R,2R)-2-(6-methoxy-4,4-dimethylhex-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate has a molecular weight of 380.53 g/mol, XLogP of 4.28, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(1R,2R)-2-(6-methoxy-4,4-dimethylhex-1-enyl)-5-oxocyclopentyl]-2-oxoheptanoate is sourced from PubChem (CID 54088899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).