About 2-chloroethylthiourea
2-chloroethylthiourea (PubChem CID 54089131) has the molecular formula C3H7ClN2S
and a molecular weight of 138.62 g/mol. Its IUPAC name is 2-chloroethylthiourea.
Molecular Properties
| Compound Name | 2-chloroethylthiourea |
| PubChem CID | 54089131 |
| Molecular Formula | C3H7ClN2S |
| Molecular Weight | 138.62 g/mol |
| Exact Mass | 138.00 |
| IUPAC Name | 2-chloroethylthiourea |
| SMILES | NC(=S)NCCCl |
| InChI | InChI=1S/C3H7ClN2S/c4-1-2-6-3(5)7/h1-2H2,(H3,5,6,7) |
| InChIKey | MSPOLKDRZJCLMQ-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.62 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethylthiourea?
The IUPAC name of 2-chloroethylthiourea (CID 54089131) is 2-chloroethylthiourea.
What is the SMILES notation for 2-chloroethylthiourea?
The canonical SMILES for 2-chloroethylthiourea is NC(=S)NCCCl.
What is the InChIKey of 2-chloroethylthiourea?
The InChIKey is MSPOLKDRZJCLMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7ClN2S/c4-1-2-6-3(5)7/h1-2H2,(H3,5,6,7).
What are the key properties of 2-chloroethylthiourea?
2-chloroethylthiourea has a molecular weight of 138.62 g/mol, XLogP of 0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethylthiourea is sourced from PubChem (CID 54089131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).