C12H13F11O3 — CID 54089133
6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]hex-1-ene (PubChem CID 54089133) has the molecular formula C12H13F11O3 and a molecular weight of 414.21 g/mol. Its IUPAC name is 6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]hex-1-ene.
| Compound Name | 6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]hex-1-ene |
|---|---|
| PubChem CID | 54089133 |
| Molecular Formula | C12H13F11O3 |
| Molecular Weight | 414.21 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 6-[2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,2-pentafluoroethoxy)ethoxy]ethoxy]hex-1-ene |
| SMILES | C=CCCCCOCC(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H13F11O3/c1-2-3-4-5-6-24-7-8(13,14)25-11(20,21)12(22,23)26-10(18,19)9(15,16)17/h2H,1,3-7H2 |
| InChIKey | MSPPMSOUOKBQFA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.21 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|