About ethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-propylpyrazole-5-carboxylate
ethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-propylpyrazole-5-carboxylate (PubChem CID 54089339) has the molecular formula C19H21N3O4
and a molecular weight of 355.39 g/mol. Its IUPAC name is ethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-propylpyrazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-propylpyrazole-5-carboxylate |
| PubChem CID | 54089339 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | ethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-propylpyrazole-5-carboxylate |
| SMILES | CCCc1cc(C(=O)OCC)n(CCN2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C19H21N3O4/c1-3-7-13-12-16(19(25)26-4-2)22(20-13)11-10-21-17(23)14-8-5-6-9-15(14)18(21)24/h5-6,8-9,12H,3-4,7,10-11H2,1-2H3 |
| InChIKey | MSTDVHTYAFCZJP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-propylpyrazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-propylpyrazole-5-carboxylate?
The IUPAC name of ethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-propylpyrazole-5-carboxylate (CID 54089339) is ethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-propylpyrazole-5-carboxylate.
What is the SMILES notation for ethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-propylpyrazole-5-carboxylate?
The canonical SMILES for ethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-propylpyrazole-5-carboxylate is CCCc1cc(C(=O)OCC)n(CCN2C(=O)c3ccccc3C2=O)n1.
What is the InChIKey of ethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-propylpyrazole-5-carboxylate?
The InChIKey is MSTDVHTYAFCZJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O4/c1-3-7-13-12-16(19(25)26-4-2)22(20-13)11-10-21-17(23)14-8-5-6-9-15(14)18(21)24/h5-6,8-9,12H,3-4,7,10-11H2,1-2H3.
What are the key properties of ethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-propylpyrazole-5-carboxylate?
ethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-propylpyrazole-5-carboxylate has a molecular weight of 355.39 g/mol, XLogP of 2.31, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-propylpyrazole-5-carboxylate is sourced from PubChem (CID 54089339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).