C23H28OS — CID 54089575
(8R,9S,10R,13S,14S)-10,13-dimethyl-17-thiophen-2-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 54089575) has the molecular formula C23H28OS and a molecular weight of 352.54 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-10,13-dimethyl-17-thiophen-2-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-17-thiophen-2-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 54089575 |
| Molecular Formula | C23H28OS |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (8R,9S,10R,13S,14S)-10,13-dimethyl-17-thiophen-2-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3cccs3)=CC[C@@H]12 |
| InChI | InChI=1S/C23H28OS/c1-22-11-9-16(24)14-15(22)5-6-17-18-7-8-20(21-4-3-13-25-21)23(18,2)12-10-19(17)22/h3-5,8,13,17-19H,6-7,9-12,14H2,1-2H3/t17-,18-,19-,22-,23-/m0/s1 |
| InChIKey | MSXCJZGCNBCMNA-PTRTWWQBSA-N |
| XLogP | 6.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|