About 9-iodo-2,3-dihydro-1-benzoxepine-4-carbaldehyde
9-iodo-2,3-dihydro-1-benzoxepine-4-carbaldehyde (PubChem CID 54089702) has the molecular formula C11H9IO2
and a molecular weight of 300.09 g/mol. Its IUPAC name is 9-iodo-2,3-dihydro-1-benzoxepine-4-carbaldehyde.
Molecular Properties
| Compound Name | 9-iodo-2,3-dihydro-1-benzoxepine-4-carbaldehyde |
| PubChem CID | 54089702 |
| Molecular Formula | C11H9IO2 |
| Molecular Weight | 300.09 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | 9-iodo-2,3-dihydro-1-benzoxepine-4-carbaldehyde |
| SMILES | O=CC1=Cc2cccc(I)c2OCC1 |
| InChI | InChI=1S/C11H9IO2/c12-10-3-1-2-9-6-8(7-13)4-5-14-11(9)10/h1-3,6-7H,4-5H2 |
| InChIKey | NYZDBLBYPIWAIV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.09 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 9-iodo-2,3-dihydro-1-benzoxepine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-iodo-2,3-dihydro-1-benzoxepine-4-carbaldehyde?
The IUPAC name of 9-iodo-2,3-dihydro-1-benzoxepine-4-carbaldehyde (CID 54089702) is 9-iodo-2,3-dihydro-1-benzoxepine-4-carbaldehyde.
What is the SMILES notation for 9-iodo-2,3-dihydro-1-benzoxepine-4-carbaldehyde?
The canonical SMILES for 9-iodo-2,3-dihydro-1-benzoxepine-4-carbaldehyde is O=CC1=Cc2cccc(I)c2OCC1.
What is the InChIKey of 9-iodo-2,3-dihydro-1-benzoxepine-4-carbaldehyde?
The InChIKey is NYZDBLBYPIWAIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9IO2/c12-10-3-1-2-9-6-8(7-13)4-5-14-11(9)10/h1-3,6-7H,4-5H2.
What are the key properties of 9-iodo-2,3-dihydro-1-benzoxepine-4-carbaldehyde?
9-iodo-2,3-dihydro-1-benzoxepine-4-carbaldehyde has a molecular weight of 300.09 g/mol, XLogP of 2.66, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-iodo-2,3-dihydro-1-benzoxepine-4-carbaldehyde is sourced from PubChem (CID 54089702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).