C21H23NO2S — CID 54090077
(4aR,10bR)-8-(2-methoxyphenyl)sulfanyl-10b-methyl-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one (PubChem CID 54090077) has the molecular formula C21H23NO2S and a molecular weight of 353.49 g/mol. Its IUPAC name is (4aR,10bR)-8-(2-methoxyphenyl)sulfanyl-10b-methyl-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one.
| Compound Name | (4aR,10bR)-8-(2-methoxyphenyl)sulfanyl-10b-methyl-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 54090077 |
| Molecular Formula | C21H23NO2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | (4aR,10bR)-8-(2-methoxyphenyl)sulfanyl-10b-methyl-1,2,4,4a,5,6-hexahydrobenzo[f]quinolin-3-one |
| SMILES | COc1ccccc1Sc1ccc2c(c1)CC[C@H]1NC(=O)CC[C@]21C |
| InChI | InChI=1S/C21H23NO2S/c1-21-12-11-20(23)22-19(21)10-7-14-13-15(8-9-16(14)21)25-18-6-4-3-5-17(18)24-2/h3-6,8-9,13,19H,7,10-12H2,1-2H3,(H,22,23)/t19-,21-/m1/s1 |
| InChIKey | MTFMGYXGHDUVCP-TZIWHRDSSA-N |
| XLogP | 4.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |