About dodec-1-enyl propanoate
dodec-1-enyl propanoate (PubChem CID 54090188) has the molecular formula C15H28O2
and a molecular weight of 240.39 g/mol. Its IUPAC name is dodec-1-enyl propanoate.
Molecular Properties
| Compound Name | dodec-1-enyl propanoate |
| PubChem CID | 54090188 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | dodec-1-enyl propanoate |
| SMILES | CCCCCCCCCCC=COC(=O)CC |
| InChI | InChI=1S/C15H28O2/c1-3-5-6-7-8-9-10-11-12-13-14-17-15(16)4-2/h13-14H,3-12H2,1-2H3 |
| InChIKey | MTHNSONZKAQUEC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze dodec-1-enyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodec-1-enyl propanoate?
The IUPAC name of dodec-1-enyl propanoate (CID 54090188) is dodec-1-enyl propanoate.
What is the SMILES notation for dodec-1-enyl propanoate?
The canonical SMILES for dodec-1-enyl propanoate is CCCCCCCCCCC=COC(=O)CC.
What is the InChIKey of dodec-1-enyl propanoate?
The InChIKey is MTHNSONZKAQUEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O2/c1-3-5-6-7-8-9-10-11-12-13-14-17-15(16)4-2/h13-14H,3-12H2,1-2H3.
What are the key properties of dodec-1-enyl propanoate?
dodec-1-enyl propanoate has a molecular weight of 240.39 g/mol, XLogP of 4.98, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dodec-1-enyl propanoate is sourced from PubChem (CID 54090188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).