About 3-ethylsulfanyl-6-(4-methoxyphenyl)-4-morpholin-4-yl-1,2,4-triazin-5-one
3-ethylsulfanyl-6-(4-methoxyphenyl)-4-morpholin-4-yl-1,2,4-triazin-5-one (PubChem CID 54090652) has the molecular formula C16H20N4O3S
and a molecular weight of 348.43 g/mol. Its IUPAC name is 3-ethylsulfanyl-6-(4-methoxyphenyl)-4-morpholin-4-yl-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 3-ethylsulfanyl-6-(4-methoxyphenyl)-4-morpholin-4-yl-1,2,4-triazin-5-one |
| PubChem CID | 54090652 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 3-ethylsulfanyl-6-(4-methoxyphenyl)-4-morpholin-4-yl-1,2,4-triazin-5-one |
| SMILES | CCSc1nnc(-c2ccc(OC)cc2)c(=O)n1N1CCOCC1 |
| InChI | InChI=1S/C16H20N4O3S/c1-3-24-16-18-17-14(12-4-6-13(22-2)7-5-12)15(21)20(16)19-8-10-23-11-9-19/h4-7H,3,8-11H2,1-2H3 |
| InChIKey | MTPKFZYHFMMYDO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-ethylsulfanyl-6-(4-methoxyphenyl)-4-morpholin-4-yl-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylsulfanyl-6-(4-methoxyphenyl)-4-morpholin-4-yl-1,2,4-triazin-5-one?
The IUPAC name of 3-ethylsulfanyl-6-(4-methoxyphenyl)-4-morpholin-4-yl-1,2,4-triazin-5-one (CID 54090652) is 3-ethylsulfanyl-6-(4-methoxyphenyl)-4-morpholin-4-yl-1,2,4-triazin-5-one.
What is the SMILES notation for 3-ethylsulfanyl-6-(4-methoxyphenyl)-4-morpholin-4-yl-1,2,4-triazin-5-one?
The canonical SMILES for 3-ethylsulfanyl-6-(4-methoxyphenyl)-4-morpholin-4-yl-1,2,4-triazin-5-one is CCSc1nnc(-c2ccc(OC)cc2)c(=O)n1N1CCOCC1.
What is the InChIKey of 3-ethylsulfanyl-6-(4-methoxyphenyl)-4-morpholin-4-yl-1,2,4-triazin-5-one?
The InChIKey is MTPKFZYHFMMYDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O3S/c1-3-24-16-18-17-14(12-4-6-13(22-2)7-5-12)15(21)20(16)19-8-10-23-11-9-19/h4-7H,3,8-11H2,1-2H3.
What are the key properties of 3-ethylsulfanyl-6-(4-methoxyphenyl)-4-morpholin-4-yl-1,2,4-triazin-5-one?
3-ethylsulfanyl-6-(4-methoxyphenyl)-4-morpholin-4-yl-1,2,4-triazin-5-one has a molecular weight of 348.43 g/mol, XLogP of 1.39, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylsulfanyl-6-(4-methoxyphenyl)-4-morpholin-4-yl-1,2,4-triazin-5-one is sourced from PubChem (CID 54090652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).