C8H14N4O — CID 54090915
2-(1,2,5,6-tetrahydropyrimidin-2-yl)-1,3-diazinan-4-one (PubChem CID 54090915) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-(1,2,5,6-tetrahydropyrimidin-2-yl)-1,3-diazinan-4-one.
| Compound Name | 2-(1,2,5,6-tetrahydropyrimidin-2-yl)-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 54090915 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-(1,2,5,6-tetrahydropyrimidin-2-yl)-1,3-diazinan-4-one |
| SMILES | O=C1CCNC(C2N=CCCN2)N1 |
| InChI | InChI=1S/C8H14N4O/c13-6-2-5-11-8(12-6)7-9-3-1-4-10-7/h3,7-8,10-11H,1-2,4-5H2,(H,12,13) |
| InChIKey | MTTZUVWKWGTTFY-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |