About [2,3,4-triacetyloxy-5-(4-nitroanilino)-5-oxopentyl] acetate
[2,3,4-triacetyloxy-5-(4-nitroanilino)-5-oxopentyl] acetate (PubChem CID 540911) has the molecular formula C19H22N2O11
and a molecular weight of 454.39 g/mol. Its IUPAC name is [2,3,4-triacetyloxy-5-(4-nitroanilino)-5-oxopentyl] acetate.
Molecular Properties
| Compound Name | [2,3,4-triacetyloxy-5-(4-nitroanilino)-5-oxopentyl] acetate |
| PubChem CID | 540911 |
| Molecular Formula | C19H22N2O11 |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [2,3,4-triacetyloxy-5-(4-nitroanilino)-5-oxopentyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H22N2O11/c1-10(22)29-9-16(30-11(2)23)17(31-12(3)24)18(32-13(4)25)19(26)20-14-5-7-15(8-6-14)21(27)28/h5-8,16-18H,9H2,1-4H3,(H,20,26) |
| InChIKey | JQMMGKHXZTXALX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 177.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2,3,4-triacetyloxy-5-(4-nitroanilino)-5-oxopentyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3,4-triacetyloxy-5-(4-nitroanilino)-5-oxopentyl] acetate?
The IUPAC name of [2,3,4-triacetyloxy-5-(4-nitroanilino)-5-oxopentyl] acetate (CID 540911) is [2,3,4-triacetyloxy-5-(4-nitroanilino)-5-oxopentyl] acetate.
What is the SMILES notation for [2,3,4-triacetyloxy-5-(4-nitroanilino)-5-oxopentyl] acetate?
The canonical SMILES for [2,3,4-triacetyloxy-5-(4-nitroanilino)-5-oxopentyl] acetate is CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)Nc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of [2,3,4-triacetyloxy-5-(4-nitroanilino)-5-oxopentyl] acetate?
The InChIKey is JQMMGKHXZTXALX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O11/c1-10(22)29-9-16(30-11(2)23)17(31-12(3)24)18(32-13(4)25)19(26)20-14-5-7-15(8-6-14)21(27)28/h5-8,16-18H,9H2,1-4H3,(H,20,26).
What are the key properties of [2,3,4-triacetyloxy-5-(4-nitroanilino)-5-oxopentyl] acetate?
[2,3,4-triacetyloxy-5-(4-nitroanilino)-5-oxopentyl] acetate has a molecular weight of 454.39 g/mol, XLogP of 0.89, 10 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3,4-triacetyloxy-5-(4-nitroanilino)-5-oxopentyl] acetate is sourced from PubChem (CID 540911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).