C19H20Cl3NO9 — CID 540912
[2,3,4-triacetyloxy-5-oxo-5-(2,4,6-trichloroanilino)pentyl] acetate (PubChem CID 540912) has the molecular formula C19H20Cl3NO9 and a molecular weight of 512.73 g/mol. Its IUPAC name is [2,3,4-triacetyloxy-5-oxo-5-(2,4,6-trichloroanilino)pentyl] acetate.
| Compound Name | [2,3,4-triacetyloxy-5-oxo-5-(2,4,6-trichloroanilino)pentyl] acetate |
|---|---|
| PubChem CID | 540912 |
| Molecular Formula | C19H20Cl3NO9 |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 511.02 |
| IUPAC Name | [2,3,4-triacetyloxy-5-oxo-5-(2,4,6-trichloroanilino)pentyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl3NO9/c1-8(24)29-7-15(30-9(2)25)17(31-10(3)26)18(32-11(4)27)19(28)23-16-13(21)5-12(20)6-14(16)22/h5-6,15,17-18H,7H2,1-4H3,(H,23,28) |
| InChIKey | DZVCIZYWXBFEKF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|