About 1-O-butan-2-yl 3-O-methyl 2-aminopropanedioate
1-O-butan-2-yl 3-O-methyl 2-aminopropanedioate (PubChem CID 54092153) has the molecular formula C8H15NO4
and a molecular weight of 189.21 g/mol. Its IUPAC name is 1-O-butan-2-yl 3-O-methyl 2-aminopropanedioate.
Molecular Properties
| Compound Name | 1-O-butan-2-yl 3-O-methyl 2-aminopropanedioate |
| PubChem CID | 54092153 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 1-O-butan-2-yl 3-O-methyl 2-aminopropanedioate |
| SMILES | CCC(C)OC(=O)C(N)C(=O)OC |
| InChI | InChI=1S/C8H15NO4/c1-4-5(2)13-8(11)6(9)7(10)12-3/h5-6H,4,9H2,1-3H3 |
| InChIKey | MUPPSWZDUPANGD-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-butan-2-yl 3-O-methyl 2-aminopropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-butan-2-yl 3-O-methyl 2-aminopropanedioate?
The IUPAC name of 1-O-butan-2-yl 3-O-methyl 2-aminopropanedioate (CID 54092153) is 1-O-butan-2-yl 3-O-methyl 2-aminopropanedioate.
What is the SMILES notation for 1-O-butan-2-yl 3-O-methyl 2-aminopropanedioate?
The canonical SMILES for 1-O-butan-2-yl 3-O-methyl 2-aminopropanedioate is CCC(C)OC(=O)C(N)C(=O)OC.
What is the InChIKey of 1-O-butan-2-yl 3-O-methyl 2-aminopropanedioate?
The InChIKey is MUPPSWZDUPANGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4/c1-4-5(2)13-8(11)6(9)7(10)12-3/h5-6H,4,9H2,1-3H3.
What are the key properties of 1-O-butan-2-yl 3-O-methyl 2-aminopropanedioate?
1-O-butan-2-yl 3-O-methyl 2-aminopropanedioate has a molecular weight of 189.21 g/mol, XLogP of -0.17, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-butan-2-yl 3-O-methyl 2-aminopropanedioate is sourced from PubChem (CID 54092153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).