C23H17ClN2O4S4 — CID 54092219
2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]-3-[2,3,4,5-tetrakis(sulfanyl)phenyl]propanoic acid (PubChem CID 54092219) has the molecular formula C23H17ClN2O4S4 and a molecular weight of 549.12 g/mol. Its IUPAC name is 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]-3-[2,3,4,5-tetrakis(sulfanyl)phenyl]propanoic acid.
| Compound Name | 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]-3-[2,3,4,5-tetrakis(sulfanyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 54092219 |
| Molecular Formula | C23H17ClN2O4S4 |
| Molecular Weight | 549.12 g/mol |
| Exact Mass | 547.98 |
| IUPAC Name | 2-[4-(6-chloroquinoxalin-2-yl)oxyphenoxy]-3-[2,3,4,5-tetrakis(sulfanyl)phenyl]propanoic acid |
| SMILES | O=C(O)C(Cc1cc(S)c(S)c(S)c1S)Oc1ccc(Oc2cnc3cc(Cl)ccc3n2)cc1 |
| InChI | InChI=1S/C23H17ClN2O4S4/c24-12-1-6-15-16(9-12)25-10-19(26-15)30-14-4-2-13(3-5-14)29-17(23(27)28)7-11-8-18(31)21(33)22(34)20(11)32/h1-6,8-10,17,31-34H,7H2,(H,27,28) |
| InChIKey | MUQUJGRLYYMPCG-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.12 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|