About 5-aminochromen-2-one
5-aminochromen-2-one (PubChem CID 54092405) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is 5-aminochromen-2-one.
Molecular Properties
| Compound Name | 5-aminochromen-2-one |
| PubChem CID | 54092405 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 5-aminochromen-2-one |
| SMILES | Nc1cccc2oc(=O)ccc12 |
| InChI | InChI=1S/C9H7NO2/c10-7-2-1-3-8-6(7)4-5-9(11)12-8/h1-5H,10H2 |
| InChIKey | MUTWEAVAMRJILI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 5-aminochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminochromen-2-one?
The IUPAC name of 5-aminochromen-2-one (CID 54092405) is 5-aminochromen-2-one.
What is the SMILES notation for 5-aminochromen-2-one?
The canonical SMILES for 5-aminochromen-2-one is Nc1cccc2oc(=O)ccc12.
What is the InChIKey of 5-aminochromen-2-one?
The InChIKey is MUTWEAVAMRJILI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c10-7-2-1-3-8-6(7)4-5-9(11)12-8/h1-5H,10H2.
What are the key properties of 5-aminochromen-2-one?
5-aminochromen-2-one has a molecular weight of 161.16 g/mol, XLogP of 1.38, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminochromen-2-one is sourced from PubChem (CID 54092405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).