C6H9N5 — CID 54092492
2-(2H-tetrazol-5-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 54092492) has the molecular formula C6H9N5 and a molecular weight of 151.17 g/mol. Its IUPAC name is 2-(2H-tetrazol-5-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 2-(2H-tetrazol-5-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 54092492 |
| Molecular Formula | C6H9N5 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | 2-(2H-tetrazol-5-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | C1=CCC(c2nn[nH]n2)NC1 |
| InChI | InChI=1S/C6H9N5/c1-2-4-7-5(3-1)6-8-10-11-9-6/h1-2,5,7H,3-4H2,(H,8,9,10,11) |
| InChIKey | MUVAPMZDXZPLBI-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|