C9H11N — CID 54092524
3,4,4a,8a-tetrahydroquinoline (PubChem CID 54092524) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 3,4,4a,8a-tetrahydroquinoline.
| Compound Name | 3,4,4a,8a-tetrahydroquinoline |
|---|---|
| PubChem CID | 54092524 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 3,4,4a,8a-tetrahydroquinoline |
| SMILES | C1=CC2CCC=NC2C=C1 |
| InChI | InChI=1S/C9H11N/c1-2-6-9-8(4-1)5-3-7-10-9/h1-2,4,6-9H,3,5H2 |
| InChIKey | JNDCUGDNXSAHQS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |