C14H28N2O6 — CID 54093203
N,N,N',N'-tetrakis(2-hydroxypropyl)oxamide (PubChem CID 54093203) has the molecular formula C14H28N2O6 and a molecular weight of 320.39 g/mol. Its IUPAC name is N,N,N',N'-tetrakis(2-hydroxypropyl)oxamide.
| Compound Name | N,N,N',N'-tetrakis(2-hydroxypropyl)oxamide |
|---|---|
| PubChem CID | 54093203 |
| Molecular Formula | C14H28N2O6 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | N,N,N',N'-tetrakis(2-hydroxypropyl)oxamide |
| SMILES | CC(O)CN(CC(C)O)C(=O)C(=O)N(CC(C)O)CC(C)O |
| InChI | InChI=1S/C14H28N2O6/c1-9(17)5-15(6-10(2)18)13(21)14(22)16(7-11(3)19)8-12(4)20/h9-12,17-20H,5-8H2,1-4H3 |
| InChIKey | MVHRZQPHASWUSL-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|