C19H24O2 — CID 54093215
3-phenyl-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)prop-2-enoic acid (PubChem CID 54093215) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 3-phenyl-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)prop-2-enoic acid.
| Compound Name | 3-phenyl-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 54093215 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 3-phenyl-2-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)prop-2-enoic acid |
| SMILES | CC1(C)C2CCC1(C)C(C(=Cc1ccccc1)C(=O)O)C2 |
| InChI | InChI=1S/C19H24O2/c1-18(2)14-9-10-19(18,3)16(12-14)15(17(20)21)11-13-7-5-4-6-8-13/h4-8,11,14,16H,9-10,12H2,1-3H3,(H,20,21) |
| InChIKey | MVIAPKPWMRVAJJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|