C19H34N2O — CID 54093804
octadeca-9,12,15-trienylurea (PubChem CID 54093804) has the molecular formula C19H34N2O and a molecular weight of 306.49 g/mol. Its IUPAC name is octadeca-9,12,15-trienylurea.
| Compound Name | octadeca-9,12,15-trienylurea |
|---|---|
| PubChem CID | 54093804 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | octadeca-9,12,15-trienylurea |
| SMILES | CCC=CCC=CCC=CCCCCCCCCNC(N)=O |
| InChI | InChI=1S/C19H34N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19(20)22/h3-4,6-7,9-10H,2,5,8,11-18H2,1H3,(H3,20,21,22) |
| InChIKey | MVRPEHNGDMSSMV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|