C50H66N2O9 — CID 54094816
but-3-en-2-one;6-[4-[5-(3-hydroxypropyl)-2-pyridinyl]phenoxy]hexan-1-ol;6-[4-[5-(3-prop-2-enylperoxypropyl)-2-pyridinyl]phenoxy]hexyl prop-2-enoate (PubChem CID 54094816) has the molecular formula C50H66N2O9 and a molecular weight of 839.08 g/mol. Its IUPAC name is but-3-en-2-one;6-[4-[5-(3-hydroxypropyl)-2-pyridinyl]phenoxy]hexan-1-ol;6-[4-[5-(3-prop-2-enylperoxypropyl)-2-pyridinyl]phenoxy]hexyl prop-2-enoate.
| Compound Name | but-3-en-2-one;6-[4-[5-(3-hydroxypropyl)-2-pyridinyl]phenoxy]hexan-1-ol;6-[4-[5-(3-prop-2-enylperoxypropyl)-2-pyridinyl]phenoxy]hexyl prop-2-enoate |
|---|---|
| PubChem CID | 54094816 |
| Molecular Formula | C50H66N2O9 |
| Molecular Weight | 839.08 g/mol |
| Exact Mass | 838.48 |
| IUPAC Name | but-3-en-2-one;6-[4-[5-(3-hydroxypropyl)-2-pyridinyl]phenoxy]hexan-1-ol;6-[4-[5-(3-prop-2-enylperoxypropyl)-2-pyridinyl]phenoxy]hexyl prop-2-enoate |
| SMILES | C=CC(C)=O.C=CCOOCCCc1ccc(-c2ccc(OCCCCCCOC(=O)C=C)cc2)nc1.OCCCCCCOc1ccc(-c2ccc(CCCO)cn2)cc1 |
| InChI | InChI=1S/C26H33NO5.C20H27NO3.C4H6O/c1-3-17-31-32-20-9-10-22-11-16-25(27-21-22)23-12-14-24(15-13-23)29-18-7-5-6-8-19-30-26(28)4-2;22-13-3-1-2-4-15-24-19-10-8-18(9-11-19)20-12-7-17(16-21-20)6-5-14-23;1-3-4(2)5/h3-4,11-16,21H,1-2,5-10,17-20H2;7-12,16,22-23H,1-6,13-15H2;3H,1H2,2H3 |
| InChIKey | MWJMCZVLYKYRMQ-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 146.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.08 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|