C19H21NO4 — CID 54094831
methyl 4-(3-methoxy-4-phenylbut-2-enoyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate (PubChem CID 54094831) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is methyl 4-(3-methoxy-4-phenylbut-2-enoyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate.
| Compound Name | methyl 4-(3-methoxy-4-phenylbut-2-enoyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 54094831 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | methyl 4-(3-methoxy-4-phenylbut-2-enoyl)-2,5-dimethyl-1H-pyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(C)[nH]c(C)c1C(=O)C=C(Cc1ccccc1)OC |
| InChI | InChI=1S/C19H21NO4/c1-12-17(18(13(2)20-12)19(22)24-4)16(21)11-15(23-3)10-14-8-6-5-7-9-14/h5-9,11,20H,10H2,1-4H3 |
| InChIKey | MWJQOLDHVNSEDK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|