About 4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carboxylic acid
4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carboxylic acid (PubChem CID 54095264) has the molecular formula C8H12F3NO3
and a molecular weight of 227.18 g/mol. Its IUPAC name is 4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carboxylic acid.
Analyze 4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carboxylic acid?
The IUPAC name of 4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carboxylic acid (CID 54095264) is 4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carboxylic acid.
What is the SMILES notation for 4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carboxylic acid?
The canonical SMILES for 4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carboxylic acid is O=C(O)N1CCC(C(O)C(F)(F)F)CC1.
What is the InChIKey of 4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carboxylic acid?
The InChIKey is MWQZZBWDTUHCOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3NO3/c9-8(10,11)6(13)5-1-3-12(4-2-5)7(14)15/h5-6,13H,1-4H2,(H,14,15).
What are the key properties of 4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carboxylic acid?
4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carboxylic acid has a molecular weight of 227.18 g/mol, XLogP of 1.30, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carboxylic acid is sourced from PubChem (CID 54095264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).