About (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone
(2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone (PubChem CID 5409550) has the molecular formula C19H24N2O2
and a molecular weight of 312.41 g/mol. Its IUPAC name is (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone.
Molecular Properties
| Compound Name | (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone |
| PubChem CID | 5409550 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone |
| SMILES | O=C(/C=C1\NC2(CCCC2)Cc2ccccc21)N1CCOCC1 |
| InChI | InChI=1S/C19H24N2O2/c22-18(21-9-11-23-12-10-21)13-17-16-6-2-1-5-15(16)14-19(20-17)7-3-4-8-19/h1-2,5-6,13,20H,3-4,7-12,14H2/b17-13- |
| InChIKey | AIYNFUFJDLLNBI-LGMDPLHJSA-N |
| XLogP | 2.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone?
The IUPAC name of (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone (CID 5409550) is (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone.
What is the SMILES notation for (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone?
The canonical SMILES for (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone is O=C(/C=C1\NC2(CCCC2)Cc2ccccc21)N1CCOCC1.
What is the InChIKey of (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone?
The InChIKey is AIYNFUFJDLLNBI-LGMDPLHJSA-N. The full InChI is InChI=1S/C19H24N2O2/c22-18(21-9-11-23-12-10-21)13-17-16-6-2-1-5-15(16)14-19(20-17)7-3-4-8-19/h1-2,5-6,13,20H,3-4,7-12,14H2/b17-13-.
What are the key properties of (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone?
(2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone has a molecular weight of 312.41 g/mol, XLogP of 2.34, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-1-morpholin-4-yl-2-spiro[2,4-dihydroisoquinoline-3,1'-cyclopentane]-1-ylideneethanone is sourced from PubChem (CID 5409550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).