C9H20O6 — CID 54095596
(2R,3R,4R,5R)-3,4,6-trimethoxyhexane-1,2,5-triol (PubChem CID 54095596) has the molecular formula C9H20O6 and a molecular weight of 224.25 g/mol. Its IUPAC name is (2R,3R,4R,5R)-3,4,6-trimethoxyhexane-1,2,5-triol.
| Compound Name | (2R,3R,4R,5R)-3,4,6-trimethoxyhexane-1,2,5-triol |
|---|---|
| PubChem CID | 54095596 |
| Molecular Formula | C9H20O6 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (2R,3R,4R,5R)-3,4,6-trimethoxyhexane-1,2,5-triol |
| SMILES | COC[C@@H](O)[C@@H](OC)[C@H](OC)[C@H](O)CO |
| InChI | InChI=1S/C9H20O6/c1-13-5-7(12)9(15-3)8(14-2)6(11)4-10/h6-12H,4-5H2,1-3H3/t6-,7-,8-,9-/m1/s1 |
| InChIKey | MWWIYUHBCFDGTR-FNCVBFRFSA-N |
| XLogP | -1.62 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |