C16H7F17O2 — CID 54095703
benzyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate (PubChem CID 54095703) has the molecular formula C16H7F17O2 and a molecular weight of 554.20 g/mol. Its IUPAC name is benzyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate.
| Compound Name | benzyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate |
|---|---|
| PubChem CID | 54095703 |
| Molecular Formula | C16H7F17O2 |
| Molecular Weight | 554.20 g/mol |
| Exact Mass | 554.02 |
| IUPAC Name | benzyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononanoate |
| SMILES | O=C(OCc1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H7F17O2/c17-9(18,8(34)35-6-7-4-2-1-3-5-7)10(19,20)11(21,22)12(23,24)13(25,26)14(27,28)15(29,30)16(31,32)33/h1-5H,6H2 |
| InChIKey | MWYMNQGTKJSXRY-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.20 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|