About 1H-indole-2-sulfonic acid
1H-indole-2-sulfonic acid (PubChem CID 54095836) has the molecular formula C8H7NO3S
and a molecular weight of 197.22 g/mol. Its IUPAC name is 1H-indole-2-sulfonic acid.
Molecular Properties
| Compound Name | 1H-indole-2-sulfonic acid |
| PubChem CID | 54095836 |
| Molecular Formula | C8H7NO3S |
| Molecular Weight | 197.22 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 1H-indole-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C8H7NO3S/c10-13(11,12)8-5-6-3-1-2-4-7(6)9-8/h1-5,9H,(H,10,11,12) |
| InChIKey | MXALRLXMXCYNGF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1H-indole-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indole-2-sulfonic acid?
The IUPAC name of 1H-indole-2-sulfonic acid (CID 54095836) is 1H-indole-2-sulfonic acid.
What is the SMILES notation for 1H-indole-2-sulfonic acid?
The canonical SMILES for 1H-indole-2-sulfonic acid is O=S(=O)(O)c1cc2ccccc2[nH]1.
What is the InChIKey of 1H-indole-2-sulfonic acid?
The InChIKey is MXALRLXMXCYNGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3S/c10-13(11,12)8-5-6-3-1-2-4-7(6)9-8/h1-5,9H,(H,10,11,12).
What are the key properties of 1H-indole-2-sulfonic acid?
1H-indole-2-sulfonic acid has a molecular weight of 197.22 g/mol, XLogP of 1.41, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indole-2-sulfonic acid is sourced from PubChem (CID 54095836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).